CAS 725692-80-8

2-[(2-fluorophenyl)methylamino]benzoic acid

Description:

2-[(2-fluorophenyl)methylamino]benzoic acid, with the CAS number 725692-80-8, is a chemical compound characterized by its structure, which includes a benzoic acid moiety and a 2-fluorophenyl group attached via a methylamino linkage. This compound typically exhibits properties associated with both aromatic amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the carboxylic acid functional group. The presence of the fluorine atom can influence its electronic properties, potentially enhancing lipophilicity and affecting its reactivity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its stability and reactivity can be influenced by pH and the presence of other functional groups in a given environment. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₄H₁₂FNO₂

InChI: InChI=1/C14H12FNO2/c15-12-7-3-1-5-10(12)9-16-13-8-4-2-6-11(13)14(17)18/h1-8,16H,9H2,(H,17,18)

SMILES: c1ccc(c(c1)CNc1ccccc1C(=O)O)F

Synonyms:

• 2-[(2-Fluorobenzyl)Amino]Benzoic Acid
• Benzoic Acid, 2-[[(2-Fluorophenyl)Methyl]Amino]-

2-[(2-fluorobenzyl)amino]benzoic acid

CAS: 725692-80-8

Formula: C₁₄H₁₂FNO₂

Purity: 95.0%

Molecular weight: 245.253

Ref: 10-F315619