CAS 725699-03-6
:7-(Difluoromethyl)-4,5,6,7-tetrahydro-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Description:
7-(Difluoromethyl)-4,5,6,7-tetrahydro-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a tetrahydro framework and a difluoromethyl group. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of the difluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The tetrahydro structure indicates that it is a saturated derivative, which can affect its conformational flexibility and interactions with biological targets. Additionally, the methyl group at the 5-position can influence the compound's steric and electronic properties. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development and therapeutic applications. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.
Formula:C9H11F2N3O2
InChI:InChI=1S/C9H11F2N3O2/c1-4-2-6(8(10)11)14-7(12-4)3-5(13-14)9(15)16/h3-4,6,8,12H,2H2,1H3,(H,15,16)
InChI key:InChIKey=QRBDCVYZAXZQLN-UHFFFAOYSA-N
SMILES:C(F)(F)C1N2C(=CC(C(O)=O)=N2)NC(C)C1
Synonyms:- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 7-(difluoromethyl)-4,5,6,7-tetrahydro-5-methyl-
- 7-(Difluoromethyl)-4,5,6,7-tetrahydro-5-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.