CAS 725699-04-7

5-[4-(1-Methylethyl)phenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

5-[4-(1-Methylethyl)phenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a trifluoromethyl group, which is known for its electron-withdrawing properties, enhancing the compound's lipophilicity and potentially influencing its biological activity. The presence of the isopropyl group (1-methylethyl) on the phenyl ring contributes to steric hindrance, which may affect the compound's interactions with biological targets. The carboxylic acid functional group is significant for solubility and reactivity, allowing for potential interactions in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its unique structural features suggest potential applications in various fields, including drug discovery and development. As with many compounds, its specific characteristics, such as solubility, stability, and reactivity, would depend on the conditions under which it is studied.

Formula: C₁₇H₁₄F₃N₃O₂

InChI: InChI=1S/C17H14F3N3O2/c1-9(2)10-3-5-11(6-4-10)13-7-14(17(18,19)20)23-15(22-13)12(8-21-23)16(24)25/h3-9H,1-2H3,(H,24,25)

InChI key: InChIKey=YATGANCZYPICPO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C(C(F)(F)F)=CC(=N2)C3=CC=C(C(C)C)C=C3)N=C1

Synonyms:

• 5-[4-(1-Methylethyl)phenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 5-[4-(1-methylethyl)phenyl]-7-(trifluoromethyl)-