CAS 7257-29-6

Calebassine

Description:

Calebassine, with the CAS number 7257-29-6, is a chemical compound that belongs to the class of natural products known as terpenes. It is primarily derived from the calabash tree and is characterized by its unique molecular structure, which contributes to its distinct physical and chemical properties. Calebassine is typically a colorless to pale yellow liquid with a characteristic odor. It is known for its potential applications in the fragrance and flavor industry due to its pleasant scent profile. Additionally, calebassine exhibits some biological activity, which has led to interest in its potential therapeutic uses. The compound is soluble in organic solvents but has limited solubility in water, which is common for many terpenes. As with many natural products, the specific characteristics of calebassine can vary depending on its source and extraction method. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₄₀H₄₈N₄O₂

InChI: InChI=1S/C40H48N4O2/c1-5-23-21-43(3)17-15-37-27-11-7-10-14-30(27)42-36-34-26-20-32-38(16-18-44(32,4)22-24(26)6-2)28-12-8-9-13-29(28)41(40(34,38)46)35(36)33(39(37,42)45)25(23)19-31(37)43/h5-14,25-26,31-36,45-46H,15-22H2,1-4H3/q+2

InChI key: InChIKey=HVWCEUHZKLPKRE-UHFFFAOYSA-N

SMILES: OC12C34C5[N+](C)(CC3)CC(=CC)C(C1C6C(N2C=7C4=CC=CC7)C8C9(O)N6C=%10C(C9%11C%12CC8C(=CC)C[N+]%12(C)CC%11)=CC=CC%10)C5

Synonyms:

• C-Toxiferine II
• (1S,3aR,8aR,8bR,8cS,9R,10aR,11S,13aR,18aR,18bR,18cS,19R,20aR,21E,24E)-21,24-Diethylidene-2,3,8a,8b,8c,10,10a,12,13,18a,18b,18c,20,20a-tetradecahydro-8c,18c-dihydroxy-1,11-dimethyl-9H,19H-1,19:9,11-diethanoindolo[1′′,2′′,3′′:1′,7′]pyrrolo[2′′′,3′′′:6′,7′]indolo[2′,3′:4,5]pyrrolo[1,2,3-lm]pyrrolo[2,3-d]carbazolium
• Calebassine
• 9H,19H-1,19:9,11-Diethanoindolo[1′′,2′′,3′′:1′,7′]pyrrolo[2′′′,3′′′:6′,7′]indolo[2′,3′:4,5]pyrrolo[1,2,3-lm]pyrrolo[2,3-d]carbazolium, 21,24-diethylidene-2,3,8a,8b,8c,10,10a,12,13,18a,18b,18c,20,20a-tetradecahydro-8c,18c-dihydroxy-1,11-dimethyl-, (1S,3aR,8aR,8bR,8cS,9R,10aR,11S,13aR,18aR,18bR,18cS,19R,20aR,21E,24E)-
• C-Calebassine

Calebassine

CAS: 7257-29-6

Calebassine is a natural alkaloid product, which is extracted from the fruit of the plant Crescentia cujete. It operates by modulating biochemical pathways within biological systems, potentially affecting neurotransmitter functions. Its mode of action involves binding to specific receptor subtypes, thereby influencing signaling mechanisms that can alter physiological processes.

Formula: C₄₀H₄₈N₄O₂

Purity: Min. 95%

Molecular weight: 616.8 g/mol

Ref: 3D-HAA25729