CAS 725702-35-2
:2-ethoxybenzenecarbothioamide
Description:
2-Ethoxybenzenecarbothioamide, identified by its CAS number 725702-35-2, is an organic compound characterized by the presence of both an ethoxy group and a carbothioamide functional group attached to a benzene ring. This compound typically exhibits properties associated with thioamides, such as potential reactivity in nucleophilic substitution reactions due to the presence of the sulfur atom. The ethoxy group contributes to its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The structure suggests that it may participate in hydrogen bonding due to the amide functionality, which can affect its physical properties, such as boiling and melting points. Additionally, compounds of this nature may have applications in medicinal chemistry or materials science, depending on their specific reactivity and functionalization potential. As with many organic compounds, safety and handling precautions should be observed, as thioamides can exhibit toxicity or irritant properties.
Formula:C9H11NOS
InChI:InChI=1/C9H11NOS/c1-2-11-8-6-4-3-5-7(8)9(10)12/h3-6H,2H2,1H3,(H2,10,12)
SMILES:CCOc1ccccc1C(=N)S
Synonyms:- Benzenecarbothioamide, 2-Ethoxy-
- 2-Ethoxybenzenecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
