CymitQuimica logo

CAS 725705-50-0

:

7-Chloro-8-methyl-2-(3-methylphenyl)-4-quinolinecarboxylic acid

Description:
7-Chloro-8-methyl-2-(3-methylphenyl)-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 7-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique chemical properties. Additionally, it has a 3-methylphenyl substituent at the 2-position, enhancing its hydrophobic characteristics and potentially influencing its biological activity. The carboxylic acid functional group at the 4-position provides acidic properties, allowing for potential interactions in biological systems, such as hydrogen bonding or ionic interactions. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many quinoline derivatives, it may also possess antimicrobial or antitumor properties, although specific biological activities would require further investigation.
Formula:C18H14ClNO2
InChI:InChI=1S/C18H14ClNO2/c1-10-4-3-5-12(8-10)16-9-14(18(21)22)13-6-7-15(19)11(2)17(13)20-16/h3-9H,1-2H3,(H,21,22)
InChI key:InChIKey=ZQUGUBWZURTKAI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC(C)=CC=C3)C(C)=C(Cl)C=C2
Synonyms:
  • 7-Chloro-8-methyl-2-(3-methylphenyl)-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 7-chloro-8-methyl-2-(3-methylphenyl)-
  • 7-CHLORO-8-METHYL-2-(3-METHYLPHENYL)QUINOLINE-4-CARBOXYLIC ACID
  • 7-Chloro-8-methyl-2-(m-tolyl)quinoline-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.