
CAS 725710-57-6
:2-Chloro-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethanone
Description:
2-Chloro-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethanone, with CAS number 725710-57-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a pyrrole ring, and a difluoromethoxy-substituted phenyl moiety. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, which can influence its solubility in organic solvents. The chloro and difluoromethoxy substituents may impart unique reactivity and stability characteristics, making it of interest in medicinal chemistry and drug development. The presence of the pyrrole ring suggests potential biological activity, as pyrrole derivatives are often associated with various pharmacological effects. Additionally, the compound's structure may allow for interactions with biological targets, making it a candidate for further investigation in therapeutic applications. Overall, its specific characteristics, including melting point, boiling point, and spectral data, would require empirical determination through experimental methods.
Formula:C15H14ClF2NO2
InChI:InChI=1S/C15H14ClF2NO2/c1-9-7-13(14(20)8-16)10(2)19(9)11-3-5-12(6-4-11)21-15(17)18/h3-7,15H,8H2,1-2H3
InChI key:InChIKey=ICGCMBPKQRXGBJ-UHFFFAOYSA-N
SMILES:CC=1N(C(C)=CC1C(CCl)=O)C2=CC=C(OC(F)F)C=C2
Synonyms:- 2-Chloro-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl]ethanone
- Ethanone, 2-chloro-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.