CAS 725743-46-4

(1S)-2,2-Dimethylcyclopropanemethanamine

Description:

(1S)-2,2-Dimethylcyclopropanemethanamine, with the CAS number 725743-46-4, is an organic compound characterized by its unique cyclopropane structure, which features two methyl groups attached to the cyclopropane ring and an amine functional group. This compound is a chiral amine, meaning it exists in two enantiomeric forms, with the (1S) designation indicating its specific stereochemistry. The presence of the amine group suggests potential basicity and reactivity, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. Its molecular structure contributes to its physical properties, such as boiling point and solubility, which are influenced by the steric hindrance introduced by the dimethyl groups. Additionally, the compound may exhibit specific biological activities, making it relevant in medicinal chemistry. Overall, (1S)-2,2-Dimethylcyclopropanemethanamine is a compound of interest due to its structural features and potential applications in various fields of chemistry.

Formula: C₆H₁₃N

InChI: InChI=1S/C6H13N/c1-6(2)3-5(6)4-7/h5H,3-4,7H2,1-2H3/t5-/m1/s1

InChI key: InChIKey=FPMPHZAUZKHZNK-RXMQYKEDSA-N

SMILES: C(N)[C@@H]1C(C)(C)C1

Synonyms:

• (1S)-2,2-Dimethylcyclopropanemethanamine
• Cyclopropanemethanamine, 2,2-dimethyl-, (1S)-
• [(1S)-2,2-Dimethylcyclopropyl]methanamine