CAS 72576-13-7
:6-(dimethylamino)-3-(4-hydroxycyclohexyl)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione
Description:
6-(Dimethylamino)-3-(4-hydroxycyclohexyl)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione, with CAS number 72576-13-7, is a chemical compound that belongs to the class of triazine derivatives. This substance is characterized by its triazine ring structure, which is substituted with a dimethylamino group and a hydroxycyclohexyl moiety. The presence of the dimethylamino group contributes to its potential as a nucleophilic site, while the hydroxycyclohexyl group may influence its solubility and reactivity. The compound is known for its applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. It typically exhibits moderate to high stability under standard conditions, although its reactivity can vary depending on the specific environment and conditions. Additionally, the compound may display unique optical properties, making it of interest in materials science. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C12H20N4O3
InChI:InChI=1/C12H20N4O3/c1-14(2)10-13-11(18)16(12(19)15(10)3)8-4-6-9(17)7-5-8/h8-9,17H,4-7H2,1-3H3
SMILES:CN(C)c1nc(=O)n(C2CCC(CC2)O)c(=O)n1C
Synonyms:- 1,3,5-Triazine-2,4(1H,3H)-dione, 6-(dimethylamino)-3-(4-hydroxycyclohexyl)-1-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hexazinone metabolite A 100 µg/mL in Acetonitrile
CAS:Formula:C12H20N4O3Color and Shape:Single SolutionMolecular weight:268.3122rel-trans-6-(Dimethylamino)-3-(4-hydroxycyclohexyl)-1-methyl-1,3,5-Triazine-2,4(1H,3H)-dione
CAS:Controlled ProductFormula:C12H20N4O3Color and Shape:NeatMolecular weight:268.31Hexazinone metabolite A
CAS:Hexazinone metabolite A is a chemical compound derived from the degradation of the parent herbicide hexazinone, which is commonly used in agriculture and forestry for broad-spectrum weed control. This metabolite is a result of microbial and environmental processes that modify the original chemical structure, altering its behavior and ecological interactions. With a mode of action involving the disruption of photosynthetic processes, Hexazinone metabolite A impacts plant growth by inhibiting photosystem II, thereby impeding electron transfer required for photosynthesis.Formula:C12H20N4O3Purity:Min. 95%Molecular weight:268.31 g/mol


