CAS 72576-14-8

1-(4-hydroxycyclohexyl)-3-methyl-1,3,5-triazinane-2,4,6-trione

Description:

1-(4-Hydroxycyclohexyl)-3-methyl-1,3,5-triazinane-2,4,6-trione, commonly referred to by its CAS number 72576-14-8, is a chemical compound characterized by its triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. This substance features a hydroxyl group attached to a cyclohexyl moiety, contributing to its potential solubility and reactivity in various chemical environments. The presence of the trione functional groups indicates that it has three carbonyl functionalities, which can participate in hydrogen bonding and other interactions, influencing its chemical behavior and stability. This compound is often studied for its applications in fields such as materials science and pharmaceuticals, where its unique structural features may impart specific properties, such as UV absorption or antioxidant activity. Additionally, its molecular structure suggests potential for further derivatization, making it a candidate for various synthetic applications. As with many chemical substances, safety and handling precautions should be observed due to its potential reactivity and biological effects.

Formula: C₁₀H₁₅N₃O₄

InChI: InChI=1/C10H15N3O4/c1-12-8(15)11-9(16)13(10(12)17)6-2-4-7(14)5-3-6/h6-7,14H,2-5H2,1H3,(H,11,15,16)

SMILES: Cn1c(nc(=O)n(C2CCC(CC2)O)c1=O)O

Synonyms:

• 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1-(4-hydroxycyclohexyl)-3-methyl-

Hexazinone metabolite E

CAS: 72576-14-8

Formula: C₁₀H₁₅N₃O₄

Color and Shape: Neat

Molecular weight: 241.24

Ref: 04-C14200034

rel-trans-1-(4-Hydroxycyclohexyl)-3-methyl-1,3,5-triazinane-2,4,6-trione

Controlled Product

CAS: 72576-14-8

Formula: C₁₀H₁₅N₃O₄

Color and Shape: White To Off-White

Molecular weight: 241.244

Ref: TR-D485585

Hexazinone metabolite E

CAS: 72576-14-8

Hexazinone metabolite E is a degradation product of the herbicide Hexazinone, which is derived from synthetic chemical processes. This metabolite emerges as a result of the biochemical breakdown of Hexazinone in soil and water environments. The mode of action involves the contamination and persistence in various environmental matrices, making it a key compound of interest for understanding the environmental impact of herbicide application. Hexazinone initially acts by inhibiting photosynthesis in plants, and its metabolites, including metabolite E, provide insights into the degradation pathways and long-term behavior of the herbicide in ecosystems.

Formula: C₁₀H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 241.24 g/mol

Ref: 3D-XCA57614