CAS 72585-17-2
:(4-chlorophenyl)[4-(methylsulfanyl)phenyl]methanone
Description:
The chemical substance known as (4-chlorophenyl)[4-(methylsulfanyl)phenyl]methanone, with the CAS number 72585-17-2, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of a chlorophenyl group and a methylsulfanyl group contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure suggests that it could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the electron-withdrawing effects of the chlorine atom and the electron-donating nature of the methylsulfanyl group. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and the presence of functional groups. Overall, (4-chlorophenyl)[4-(methylsulfanyl)phenyl]methanone represents a class of compounds that may have applications in medicinal chemistry and materials science.
Formula:C14H11ClOS
InChI:InChI=1/C14H11ClOS/c1-17-13-8-4-11(5-9-13)14(16)10-2-6-12(15)7-3-10/h2-9H,1H3
SMILES:CSc1ccc(cc1)C(=O)c1ccc(cc1)Cl
Synonyms:- Methanone, (4-chlorophenyl)[4-(methylthio)phenyl]-
- (4-Chlorophenyl)[4-(methylsulfanyl)phenyl]methanone
- 4-CHLORO-4'-(METHYLTHIO)BENZOPHENONE
- (4-CHLORO-PHENYL)-(4-METHYLSULFANYL-PHENYL)-METHANONE
- 4-CHLORO-4'-(THIOMETHYL)BENZOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.