CAS 72585-88-7
:3-(4-hydroxycyclohexyl)-1-methyl-6-(methylamino)-1,3,5-triazine-2,4(1H,3H)-dione
Description:
3-(4-Hydroxycyclohexyl)-1-methyl-6-(methylamino)-1,3,5-triazine-2,4(1H,3H)-dione, with the CAS number 72585-88-7, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered heterocyclic structure containing three nitrogen atoms. The presence of a hydroxyl group on the cyclohexyl moiety contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. The methylamino group enhances its basicity and may play a role in interactions with biological targets. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications as a herbicide or in other biological activities. Its structural characteristics suggest it may exhibit specific interactions with enzymes or receptors, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C11H18N4O3
InChI:InChI=1/C11H18N4O3/c1-12-9-13-10(17)15(11(18)14(9)2)7-3-5-8(16)6-4-7/h7-8,16H,3-6H2,1-2H3,(H,12,13,17)
SMILES:CN=c1nc(n(C2CCC(CC2)O)c(=O)n1C)O
Synonyms:- 1,3,5-Triazine-2,4(1H,3H)-dione, 3-(4-hydroxycyclohexyl)-1-methyl-6-(methylamino)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hexazinone metabolite C 100 µg/mL in Acetonitrile
CAS:Formula:C11H18N4O3Color and Shape:Single SolutionMolecular weight:254.29rel-trans-N-Desmethyl 4-Hydroxy Hexazinone
CAS:Controlled ProductFormula:C11H18N4O3Color and Shape:White To Off-WhiteMolecular weight:254.29Hexazinone metabolite C
CAS:<p>Hexazinone Metabolite C is a chemical compound that serves as a marker for the metabolic degradation of hexazinone, a systemic herbicide. This metabolite is derived from the biological and chemical transformation processes that hexazinone undergoes when applied to plants and soil environments.</p>Formula:C11H18N4O3Purity:Min. 95%Molecular weight:254.29 g/mol


