CAS 72594-86-6
:Benzyl tert-butyl malonate
Description:
Benzyl tert-butyl malonate, with the CAS number 72594-86-6, is an organic compound characterized by its structure, which includes a malonate moiety esterified with a benzyl group and a tert-butyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. Benzyl tert-butyl malonate is often employed as a building block in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the malonate group, which can undergo various chemical transformations, such as alkylation and condensation reactions. Additionally, it may exhibit properties such as stability under standard conditions, but care should be taken regarding its handling and storage, as with many organic compounds, to avoid potential hazards.
Formula:C14H18O4
InChI:InChI=1/C14H18O4/c1-14(2,3)18-13(16)9-12(15)17-10-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3
SMILES:CC(C)(C)OC(=O)CC(=O)OCc1ccccc1
Synonyms:- Malonic acid benzyl tert-butyl ester
- Benzyl Tert-Butyl Propanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzyl tert-butyl malonate, 95%
CAS:<p>Benzyl tert-butyl malonate is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU ref</p>Formula:C14H18O4Purity:95%Color and Shape:Liquid, Clear colorlessMolecular weight:250.29BENZYL TERT-BUTYL MALONATE
CAS:Formula:C14H18O4Purity:97%Color and Shape:LiquidMolecular weight:250.2903Benzyl tert-butyl malonate
CAS:Benzyl tert-butyl malonateFormula:C14H18O4Purity:90%Color and Shape: clear. colourless liquidMolecular weight:250.29g/molBenzyl tert-butyl malonate
CAS:Formula:C14H18O4Purity:95%Color and Shape:LiquidMolecular weight:250.294
