CAS 726-25-0
:1-benzyl-3-phenylthiourea
Description:
1-Benzyl-3-phenylthiourea is an organic compound characterized by its thiourea functional group, which consists of a carbon atom double-bonded to sulfur and single-bonded to nitrogen. This compound features a benzyl group and a phenyl group, contributing to its aromatic nature and potentially influencing its solubility and reactivity. It typically appears as a white to off-white crystalline solid. The presence of the thiourea moiety suggests that it may exhibit biological activity, including potential applications in medicinal chemistry, such as acting as an inhibitor or modulator in various biochemical pathways. Additionally, its structure allows for hydrogen bonding, which can affect its interactions with other molecules. The compound is soluble in organic solvents, but its solubility in water is limited. Safety data indicates that it should be handled with care, as thiourea derivatives can exhibit toxicity and may pose environmental hazards. Overall, 1-benzyl-3-phenylthiourea is of interest in both synthetic and biological chemistry contexts.
Formula:C14H14N2S
InChI:InChI=1/C14H14N2S/c17-14(16-13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,15,16,17)
SMILES:c1ccc(cc1)CN=C(Nc1ccccc1)S
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Thiourea, N-phenyl-N'-(phenylmethyl)-
CAS:Formula:C14H14N2SPurity:98%Color and Shape:SolidMolecular weight:242.33941-Benzyl-3-Phenylthiourea
CAS:1-Benzyl-3-Phenylthiourea (1-Benzyl-3-Phenyl-2-Thiourea) can be used as a sensing material for the detection of nerve agents and related stimulants.Formula:C14H14N2SPurity:99.98%Color and Shape:SolidMolecular weight:242.341-Benzyl-3-phenylthiourea
CAS:Formula:C14H14N2SPurity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:242.341-Benzyl-3-phenyl-2-thiourea
CAS:Formula:C14H14N2SPurity:98%Color and Shape:SolidMolecular weight:242.341-Benzyl-3-phenylthiourea
CAS:1-Benzyl-3-phenylthiourea is a molecule that has been shown to inhibit corrosion in the presence of blood pressure. It has also been shown to be a potent inhibitor of hexamethylenetetramine, an organic compound that is used as a corrosion inhibitor. 1-Benzyl-3-phenylthiourea can be used as a biomimetic corrosion inhibitor for blood pressure and sensitivity tests. It is also capable of membrane hyperpolarization, which can be used to prevent nerve cell death from lack of oxygen and glucose.Formula:C14H14N2SPurity:Min. 95%Molecular weight:242.34 g/mol





