CAS 726-89-6

N-[bis(aziridin-1-yl)phosphoryl]-2-fluorobenzamide

Description:

N-[bis(aziridin-1-yl)phosphoryl]-2-fluorobenzamide, with the CAS number 726-89-6, is a chemical compound characterized by its unique structure that includes a phosphorus atom bonded to two aziridine rings and a 2-fluorobenzamide moiety. This compound typically exhibits properties associated with both phosphorus-containing compounds and aziridine derivatives, such as potential reactivity due to the presence of the aziridine rings, which can undergo ring-opening reactions. The fluorine atom in the benzamide portion may influence the compound's electronic properties and reactivity, potentially enhancing its biological activity or stability. Additionally, the presence of the phosphoryl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, N-[bis(aziridin-1-yl)phosphoryl]-2-fluorobenzamide represents a complex and potentially versatile chemical entity in synthetic and medicinal chemistry.

Formula: C₁₁H₁₃FN₃O₂P

InChI: InChI=1/C11H13FN3O2P/c12-10-4-2-1-3-9(10)11(16)13-18(17,14-5-6-14)15-7-8-15/h1-4H,5-8H2,(H,13,16,17)

SMILES: c1ccc(c(c1)C(=NP(=O)(N1CC1)N1CC1)O)F