CymitQuimica logo

CAS 7260-94-8

:

N,N-Dimethylcarbamic acid

Description:
N,N-Dimethylcarbamic acid is an organic compound characterized by its carbamate functional group, which features a carbonyl group (C=O) bonded to a nitrogen atom that is further bonded to two methyl groups. This compound is typically a colorless to pale yellow liquid with a faint odor. It is soluble in water and various organic solvents, making it versatile in chemical applications. N,N-Dimethylcarbamic acid is known for its role as an intermediate in the synthesis of pesticides, pharmaceuticals, and other organic compounds. It exhibits moderate toxicity, and appropriate safety measures should be taken when handling it. The compound can undergo hydrolysis, leading to the formation of dimethylamine and carbonic acid, which are important in various biochemical processes. Its reactivity is influenced by the presence of the carbamate group, allowing it to participate in nucleophilic substitution reactions. Overall, N,N-Dimethylcarbamic acid is significant in both industrial and research settings due to its chemical properties and applications.
Formula:C3H7NO2
InChI:InChI=1S/C3H7NO2/c1-4(2)3(5)6/h1-2H3,(H,5,6)
InChI key:InChIKey=DWLVWMUCHSLGSU-UHFFFAOYSA-N
SMILES:C(N(C)C)(O)=O
Synonyms:
  • Carbamic acid, N,N-dimethyl-
  • Dimethylcarbamic acid
  • N,N-Dimethylcarbamic acid
  • N,N-Dimethylcarbamate
  • Carbamic acid, dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.