
CAS 72601-54-8
:1-(4-Ethylphenyl)-2,5-pyrrolidinedione
Description:
1-(4-Ethylphenyl)-2,5-pyrrolidinedione, also known as a derivative of pyrrolidine, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and an ethylphenyl substituent. This compound typically exhibits properties associated with both aromatic and cyclic structures, which can influence its reactivity and solubility. It is often studied for its potential applications in pharmaceuticals and organic synthesis due to its ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of the ethylphenyl group may enhance its lipophilicity, affecting its biological activity and interaction with cellular targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c1-2-9-3-5-10(6-4-9)13-11(14)7-8-12(13)15/h3-6H,2,7-8H2,1H3
InChI key:InChIKey=KMLYSUSELYDIOD-UHFFFAOYSA-N
SMILES:O=C1N(C2=CC=C(CC)C=C2)C(=O)CC1
Synonyms:- 1-(4-Ethylphenyl)-2,5-pyrrolidinedione
- 2,5-Pyrrolidinedione, 1-(4-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.