CymitQuimica logo

CAS 72602-73-4

:

1-(2-Nitrohenyl)-3-phenyl-2-thiourea

Description:
1-(2-Nitrophenyl)-3-phenyl-2-thiourea, with the CAS number 72602-73-4, is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbon atom double-bonded to sulfur and bonded to two amine groups. This compound features a nitrophenyl group and a phenyl group, contributing to its aromatic nature and potentially influencing its reactivity and solubility. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and reactivity in various chemical reactions. Typically, thioureas exhibit a range of biological activities, including potential applications in medicinal chemistry. The compound may also participate in various chemical transformations, such as nucleophilic substitutions or condensation reactions. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, 1-(2-Nitrophenyl)-3-phenyl-2-thiourea is of interest in both synthetic and medicinal chemistry contexts.
Formula:C13H11N3O2S
InChI:InChI=1/C13H11N3O2S/c17-16(18)12-9-5-4-8-11(12)15-13(19)14-10-6-2-1-3-7-10/h1-9H,(H2,14,15,19)
SMILES:c1ccc(cc1)N=C(Nc1ccccc1N(=O)=O)S
Synonyms:
  • 1-(2-Nitrophenyl)-3-Phenylthiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.