CymitQuimica logo

CAS 72612-08-9

:

3-chloro-N-[3-(1H-indol-3-yl)propyl]benzamide

Description:
3-Chloro-N-[3-(1H-indol-3-yl)propyl]benzamide, with the CAS number 72612-08-9, is a chemical compound characterized by its unique structure, which includes a benzamide moiety substituted with a chloro group and a propyl chain linked to an indole ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the indole structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The chloro substituent can influence the compound's reactivity and solubility, while the benzamide functional group may enhance its ability to form hydrogen bonds, affecting its pharmacokinetic properties. Overall, this compound's characteristics, including its molecular weight, solubility, and stability, are influenced by its specific functional groups and overall molecular architecture, which can be further explored for applications in drug development and other chemical research.
Formula:C18H17ClN2O
InChI:InChI=1/C18H17ClN2O/c19-15-7-3-5-13(11-15)18(22)20-10-4-6-14-12-21-17-9-2-1-8-16(14)17/h1-3,5,7-9,11-12,21H,4,6,10H2,(H,20,22)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.