CymitQuimica logo

CAS 72615-77-1

:

3-methyl-1-phenylpiperazin-2-one

Description:
3-Methyl-1-phenylpiperazin-2-one, with the CAS number 72615-77-1, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered cyclic amine, substituted with a methyl group at the 3-position and a phenyl group at the 1-position, along with a carbonyl group at the 2-position. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many piperazine derivatives. The presence of the phenyl group contributes to its potential for various interactions, making it of interest in medicinal chemistry, particularly for its possible pharmacological activities. Additionally, the compound may exhibit properties such as being a potential ligand for certain receptors, which could be explored in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H14N2O
InChI:InChI=1/C11H14N2O/c1-9-11(14)13(8-7-12-9)10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3
SMILES:CC1C(=O)N(CCN1)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.