CAS 726165-20-4

4-(Diphenylmethyl)-1-piperazinepropanoic acid hydrazide

Description:

4-(Diphenylmethyl)-1-piperazinepropanoic acid hydrazide, identified by its CAS number 726165-20-4, is a chemical compound that features a piperazine ring, which is a six-membered cyclic amine known for its biological activity. This compound is characterized by the presence of a diphenylmethyl group, which contributes to its lipophilicity and potential interactions with biological targets. The hydrazide functional group indicates that it contains a hydrazine moiety, which can participate in various chemical reactions, including those involving hydrazone formation. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with neurotransmitter systems. Additionally, the presence of both acidic and basic functional groups may influence its solubility and stability in different environments. Overall, this compound's unique structural features make it a subject of interest for further research in drug development and related fields.

Formula: C₂₀H₂₆N₄O

InChI: InChI=1S/C20H26N4O/c21-22-19(25)11-12-23-13-15-24(16-14-23)20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,20H,11-16,21H2,(H,22,25)

InChI key: InChIKey=MHZCKLOUKARQDP-UHFFFAOYSA-N

SMILES: C(N1CCN(CCC(NN)=O)CC1)(C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• 1-Piperazinepropanoic acid, 4-(diphenylmethyl)-, hydrazide
• 4-(Diphenylmethyl)-1-piperazinepropanoic acid hydrazide

3-[4-(Diphenylmethyl)piperazin-1-yl]propanehydrazide

CAS: 726165-20-4

Versatile small molecule scaffold

Formula: C₂₀H₂₆N₄O

Purity: Min. 95%

Molecular weight: 338.4 g/mol

Ref: 3D-BEB16520