CymitQuimica logo

CAS 72622-74-3

:

2-[(2-amino-2-methylpropyl)amino]-2-methylpropan-1-ol

Description:
2-[(2-amino-2-methylpropyl)amino]-2-methylpropan-1-ol, also known by its CAS number 72622-74-3, is an organic compound characterized by its amino alcohol structure. This substance features a branched alkyl chain, which contributes to its steric hindrance and solubility properties. It contains multiple functional groups, including amino and hydroxyl groups, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the amino groups suggests potential basicity, allowing it to act as a weak base in various chemical reactions. This compound is often studied for its role in biochemical applications, particularly in the synthesis of pharmaceuticals or as a building block in organic synthesis. Its molecular structure indicates that it may exhibit chiral properties, leading to potential enantiomeric forms. Overall, 2-[(2-amino-2-methylpropyl)amino]-2-methylpropan-1-ol is notable for its functional versatility and potential applications in medicinal chemistry and related fields.
Formula:C8H20N2O
InChI:InChI=1/C8H20N2O/c1-7(2,9)5-10-8(3,4)6-11/h10-11H,5-6,9H2,1-4H3
SMILES:CC(C)(CNC(C)(C)CO)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.