CymitQuimica logo

CAS 72632-65-6

:

5-Thiazolamine,4-methyl-

Description:
5-Thiazolamine, 4-methyl- is an organic compound characterized by its thiazole ring structure, which contains both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a methyl group (-CH3) attached to the thiazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The thiazole moiety is known for its biological activity, often serving as a building block in pharmaceuticals and agrochemicals. The compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, owing to the reactivity of the amino group. Additionally, it may exhibit properties such as antimicrobial or antifungal activity, which are common in thiazole derivatives. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper use in laboratory or industrial settings.
Formula:C4H6N2S
InChI:InChI=1S/C4H6N2S/c1-3-4(5)7-2-6-3/h2H,5H2,1H3
InChI key:IQHFLJOHGQJKFL-UHFFFAOYSA-N
SMILES:CC1=C(SC=N1)N
Synonyms:
  • 5-Thiazolamine, 4-methyl-
Found 4 products.