CymitQuimica logo

CAS 72651-25-3

:

(carboxymethyl)(hydroxymethyl)oxophosphonium

Description:
The chemical substance known as (carboxymethyl)(hydroxymethyl)oxophosphonium, with the CAS number 72651-25-3, is a phosphonium compound characterized by the presence of both carboxymethyl and hydroxymethyl functional groups attached to a phosphorus atom. This compound typically exhibits properties associated with phosphonium salts, such as being a quaternary ammonium derivative, which can influence its solubility and reactivity. The presence of the carboxymethyl group suggests potential for ionic interactions, while the hydroxymethyl group may contribute to hydrogen bonding capabilities. These features can enhance its utility in various applications, including as a reagent in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the oxophosphonium moiety indicates that the phosphorus atom is in a higher oxidation state, which can affect the compound's stability and reactivity. Overall, this compound's unique structural characteristics make it of interest in both academic research and industrial applications, particularly in fields involving organic chemistry and materials science.
Formula:C3H6O4P
InChI:InChI=1/C3H5O4P/c4-2-8(7)1-3(5)6/h4H,1-2H2/p+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.