CAS 72652-32-5
:1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethan-1-one
Description:
1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethan-1-one, with the CAS number 72652-32-5, is a synthetic organic compound characterized by its unique structure that includes a pyrrole ring substituted with a bromine atom and a trichloroethanone moiety. This compound typically exhibits a high degree of reactivity due to the presence of the electrophilic carbonyl group and the highly electronegative chlorine atoms, which can influence its chemical behavior in various reactions. It is often studied for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The presence of the bromine atom may impart specific biological activities, making it of interest in pharmacological research. Additionally, the compound's physical properties, such as solubility and stability, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a fascinating area of study within the field of organic chemistry.
Formula:C6H3BrCl3NO
InChI:InChI=1/C6H3BrCl3NO/c7-3-1-4(11-2-3)5(12)6(8,9)10/h1-2,11H
SMILES:c1c(c[nH]c1C(=O)C(Cl)(Cl)Cl)Br
Synonyms:- 1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(4-Bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone
CAS:Formula:C6H3BrCl3NOPurity:95%Color and Shape:SolidMolecular weight:291.35714-Bromo-2-(trichloroacetyl)-1H-pyrrole
CAS:4-Bromo-2-(trichloroacetyl)-1H-pyrroleFormula:C6H3BrCl3NOPurity:95%Color and Shape: grey solidMolecular weight:291.36g/mol1-(4-Bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone
CAS:Formula:C6H3BrCl3NOPurity:95%Color and Shape:SolidMolecular weight:291.351-(4-Bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone
CAS:1-(4-Bromo-1H-pyrrol-2-yl)-2,2,2-trichloroethanone is a reactant in the preparation of tetrachloride. It can be prepared by reacting 4-bromopyrrole with carbon tetrachloride. The yield of this reaction can be increased by using a catalytic amount of potassium hydroxide. The target compound is a colorless liquid with a boiling point of 104 °C. This compound has been used as an intermediate in the production of dyes, pesticides, and pharmaceuticals.
Formula:C6H3BrCl3NOPurity:Min. 95%Molecular weight:291.36 g/mol



