CAS 72668-27-0
:Phenol, 3-(1-methylethyl)-, phosphate (3:1)
Description:
Phenol, 3-(1-methylethyl)-, phosphate (3:1), commonly known as isopropyl phenyl phosphate, is an organophosphate compound characterized by its phosphate ester structure. It features a phenolic ring substituted with an isopropyl group at the meta position, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a moderate viscosity. It is soluble in organic solvents but has limited solubility in water, which affects its environmental behavior and bioavailability. Isopropyl phenyl phosphate is primarily used as a plasticizer and flame retardant in various industrial applications, including plastics and coatings. Additionally, it exhibits potential as a surfactant due to its amphiphilic nature. However, like many organophosphates, it may pose health and environmental risks, necessitating careful handling and regulation. Its chemical stability and reactivity can vary depending on environmental conditions, making it important to consider its degradation pathways in ecological assessments.
Formula:C27H33O4P
InChI:InChI=1/C27H33O4P/c1-19(2)22-10-7-13-25(16-22)29-32(28,30-26-14-8-11-23(17-26)20(3)4)31-27-15-9-12-24(18-27)21(5)6/h7-21H,1-6H3
InChI key:InChIKey=HZZVNABLNATHQO-UHFFFAOYSA-N
SMILES:P(OC1=CC(C(C)C)=CC=C1)(OC2=CC(C(C)C)=CC=C2)(OC3=CC(C(C)C)=CC=C3)=O
Synonyms:- Phenol, 3-(1-methylethyl)-, phosphate (3:1)
- Tris(m-isopropylphenyl) phosphate
- Tris[3-(Propan-2-Yl)Phenyl] Phosphate
- m-Cumenyl phosphate
- Tris(3-isopropylphenyl) phosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
m-Cumenyl Phosphate
CAS:Controlled ProductApplications m-Cumenyl Phosphate is a flame retardant and a standard for environmental testing and research.
References Suzuki, G., et al.: Environ. Sci. Technol. 47, 2898 (2013)Formula:C27H33O4PColor and Shape:NeatMolecular weight:452.52M-Cumenyl phosphate
CAS:M-Cumenyl phosphate is an analog that has shown promising results in inducing apoptosis in cancer cells. It works by inhibiting kinases, which are enzymes responsible for the transfer of phosphate groups to other molecules. M-Cumenyl phosphate has been found in urine samples from Chinese medicinal plants and has been studied extensively for its anticancer properties. This compound has shown potent activity against various types of tumors and cancer cell lines, making it a potential candidate for future cancer treatments. M-Cumenyl phosphate functions as a kinase inhibitor, specifically targeting protein kinases involved in tumor growth and progression. Its ability to selectively inhibit these proteins makes it a promising therapeutic agent for cancer treatment.Formula:C27H33O4PPurity:Min. 95%Molecular weight:452.5 g/mol

