CymitQuimica logo

CAS 7267-14-3

:

4,5-Dichloronaphthalene-1,8-Dicarboxylic Anhydride

Description:
4,5-Dichloronaphthalene-1,8-dicarboxylic anhydride, with the CAS number 7267-14-3, is a chemical compound characterized by its anhydride functional group derived from naphthalene. This compound features two carboxylic acid groups that are converted into an anhydride, resulting in a cyclic structure that enhances its reactivity. It is typically a solid at room temperature and is known for its high melting point and stability under standard conditions. The presence of chlorine substituents at the 4 and 5 positions of the naphthalene ring contributes to its chemical properties, including increased electronegativity and potential for electrophilic substitution reactions. This compound is often utilized in organic synthesis, particularly in the production of various polymers and as an intermediate in the synthesis of dyes and pharmaceuticals. Additionally, it may exhibit toxicity and environmental persistence, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C24H10Cl4O7
InChI:InChI=1/C24H10Cl4O7/c25-13-5-1-9(21(29)30)17-11(3-7-15(27)19(13)17)23(33)35-24(34)12-4-8-16(28)20-14(26)6-2-10(18(12)20)22(31)32/h1-8H,(H,29,30)(H,31,32)
SMILES:c1cc(c2c(ccc(c2c1C(=O)O)C(=O)OC(=O)c1ccc(c2c(ccc(c12)C(=O)O)Cl)Cl)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.