CymitQuimica logo

CAS 7267-29-0

:

4-Methoxy-2-benzothiazolecarboxamide

Description:
4-Methoxy-2-benzothiazolecarboxamide is an organic compound characterized by its benzothiazole structure, which features a fused benzene and thiazole ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. It possesses a methoxy group (-OCH3) and a carboxamide group (-CONH2), which contribute to its chemical reactivity and potential biological activity. The presence of the benzothiazole moiety often imparts interesting pharmacological properties, making it a subject of research in medicinal chemistry. This compound may exhibit antimicrobial, antifungal, or anticancer activities, although specific biological effects can vary based on structural modifications and the context of use. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.
Formula:C9H8N2O2S
InChI:InChI=1S/C9H8N2O2S/c1-13-5-3-2-4-6-7(5)11-9(14-6)8(10)12/h2-4H,1H3,(H2,10,12)
InChI key:InChIKey=WHOMZORUWPHGKK-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(SC(C(N)=O)=N2)=CC=C1
Synonyms:
  • 4-Methoxy-2-benzothiazolecarboxamide
  • 2-Benzothiazolecarboxamide, 4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.