CymitQuimica logo

CAS 7267-31-4

:

4-Hydroxy-2-benzothiazolecarbonitrile

Description:
4-Hydroxy-2-benzothiazolecarbonitrile, with the CAS number 7267-31-4, is an organic compound characterized by its unique structure that includes a benzothiazole moiety and a cyano group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and may show varying degrees of reactivity depending on the conditions. The presence of the hydroxyl group contributes to its ability to participate in hydrogen bonding, which can influence its solubility and reactivity. Additionally, the cyano group is known for its electron-withdrawing properties, which can affect the compound's overall chemical behavior. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4-Hydroxy-2-benzothiazolecarbonitrile is a compound of interest in synthetic chemistry and material development due to its distinctive functional groups and structural characteristics.
Formula:C8H4N2OS
InChI:InChI=1S/C8H4N2OS/c9-4-7-10-8-5(11)2-1-3-6(8)12-7/h1-3,11H
InChI key:InChIKey=OYTOVORTBXNLBB-UHFFFAOYSA-N
SMILES:OC1=C2C(SC(C#N)=N2)=CC=C1
Synonyms:
  • 4-Hydroxy-2-benzothiazolecarbonitrile
  • 2-Cyano-4-hydroxybenzothiazole
  • 2-Benzothiazolecarbonitrile, 4-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.