
CAS 72677-90-8
:6-Methoxy-5-isoquinolinamine
Description:
6-Methoxy-5-isoquinolinamine, with the CAS number 72677-90-8, is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a methoxy group (-OCH3) at the 6-position and an amino group (-NH2) at the 5-position of the isoquinoline ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability, while the amino group may participate in hydrogen bonding and interactions with biological targets. 6-Methoxy-5-isoquinolinamine may exhibit various properties such as fluorescence, depending on its environment, and could be involved in various chemical reactions typical of amines and aromatic compounds. Its specific applications and biological activities would depend on further research and characterization, including studies on its pharmacokinetics and pharmacodynamics.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-13-9-3-2-7-6-12-5-4-8(7)10(9)11/h2-6H,11H2,1H3
InChI key:InChIKey=NYIJADBRRGNJOC-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC1OC)C=NC=C2
Synonyms:- 6-Methoxy-5-isoquinolinamine
- 5-Isoquinolinamine, 6-methoxy-
- 5-Amino-6-methoxyisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.