CAS 72677-92-0
:6-methoxy-5-nitroisoquinoline
Description:
6-Methoxy-5-nitroisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methoxy group (-OCH3) at the 6-position and a nitro group (-NO2) at the 5-position contributes to its unique chemical properties. This compound is typically a yellow to orange crystalline solid and is soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The nitro group can participate in electrophilic substitution reactions, while the methoxy group can influence the compound's reactivity and polarity. 6-Methoxy-5-nitroisoquinoline is of interest in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anticancer properties. As with many nitro compounds, it may also exhibit sensitivity to reduction reactions, which can lead to the formation of amine derivatives. Proper handling and safety precautions are essential, as nitro compounds can be hazardous.
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c1-15-9-3-2-7-6-11-5-4-8(7)10(9)12(13)14/h2-6H,1H3
SMILES:COc1ccc2cnccc2c1N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Methoxy-5-nitroisoquinoline
CAS:Controlled ProductApplications A useful synthetic intermediate.
Formula:C10H8N2O3Color and Shape:NeatMolecular weight:204.18
