CAS 72678-97-8

2-(1-Naphthalenyl)-4-thiazolidinecarboxylic acid

Description:

2-(1-Naphthalenyl)-4-thiazolidinecarboxylic acid, with the CAS number 72678-97-8, is a chemical compound characterized by its thiazolidine ring structure, which incorporates a naphthalene moiety. This compound features a thiazolidine backbone, a five-membered ring containing both sulfur and nitrogen atoms, and a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of the naphthalene group imparts aromatic characteristics, influencing its solubility and interaction with other molecules. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The thiazolidine framework is often associated with various biological functions, including potential roles in metabolic processes. Additionally, the compound's structural features suggest it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties, such as melting point and solubility in different solvents. Overall, 2-(1-Naphthalenyl)-4-thiazolidinecarboxylic acid represents a unique structure with potential applications in various chemical and biological fields.

Formula: C₁₄H₁₃NO₂S

InChI: InChI=1S/C14H13NO2S/c16-14(17)12-8-18-13(15-12)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-13,15H,8H2,(H,16,17)

InChI key: InChIKey=WSGHWUWDWJRTFR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(C=2C3=C(C=CC2)C=CC=C3)SC1

Synonyms:

• 2-(Naphthalen-1-yl)-1,3-thiazolidine-4-carboxylic acid
• 2-(1-Naphthalenyl)-4-thiazolidinecarboxylic acid
• 4-Thiazolidinecarboxylic acid, 2-(1-naphthyl)-
• 4-Thiazolidinecarboxylic acid, 2-(1-naphthalenyl)-
• 2-Naphthalen-1-yl-1,3-thiazolidin-3-ium-4-carboxylate