CAS 72678-98-9

2-(2-Furanyl)-4-thiazolidinecarboxylic acid

Description:

2-(2-Furanyl)-4-thiazolidinecarboxylic acid is a heterocyclic compound characterized by the presence of both a furan ring and a thiazolidine structure. This compound features a five-membered furan ring, which contributes to its aromatic properties, and a thiazolidine ring, which contains a sulfur atom and is known for its role in various biological activities. The carboxylic acid functional group enhances its solubility in polar solvents and can participate in hydrogen bonding, making it potentially useful in various chemical reactions. The compound may exhibit biological activity, including antimicrobial or anti-inflammatory properties, due to the presence of the thiazolidine moiety. Its unique structure allows for potential applications in pharmaceuticals and agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the substituents on the furan and thiazolidine rings, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₈H₉NO₃S

InChI: InChI=1S/C8H9NO3S/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-3,5,7,9H,4H2,(H,10,11)

InChI key: InChIKey=VYGBVPOHBURDGB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1NC(SC1)C2=CC=CO2

Synonyms:

• 2-(2-Furyl)-4-carboxythiazolidine
• 4-Thiazolidinecarboxylic acid, 2-(2-furanyl)-
• 2-(2-Furanyl)-4-thiazolidinecarboxylic acid
• 4-Thiazolidinecarboxylic acid, 2-(2-furyl)-
• 2-(Furan-2-yl)-1,3-thiazolidine-4-carboxylic acid

2-(2-Furyl)-1,3-thiazolidine-4-carboxylic acid

CAS: 72678-98-9

2-(2-Furyl)-1,3-thiazolidine-4-carboxylic acid is a water-soluble plant metabolite that belongs to the group of research chemicals. It is commonly used in the development of medicines and medicaments due to its unique properties. This compound contains a morpholino and benzoate moiety, which contribute to its pharmacological effects. The presence of oxadiazole and proton groups enhances its bioavailability and stability.

Formula: C₈H₉NO₃S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 199.23 g/mol

Ref: 3D-FF168931