CymitQuimica logo

CAS 72678-99-0

:

2-(5-Methyl-2-furanyl)-4-thiazolidinecarboxylic acid

Description:
2-(5-Methyl-2-furanyl)-4-thiazolidinecarboxylic acid, with the CAS number 72678-99-0, is a chemical compound characterized by its unique structural features, which include a thiazolidine ring and a furan moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids. The presence of the thiazolidine ring suggests potential biological activity, as thiazolidines are often involved in various biochemical processes. The furan group contributes to the compound's aromatic characteristics, which can influence its reactivity and solubility. Generally, compounds like this may exhibit moderate to high polarity due to the carboxylic acid functional group, affecting their solubility in polar solvents. Additionally, the methyl substitution on the furan ring can impact the compound's steric and electronic properties, potentially enhancing its reactivity or selectivity in chemical reactions. Overall, 2-(5-Methyl-2-furanyl)-4-thiazolidinecarboxylic acid represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C9H11NO3S
InChI:InChI=1S/C9H11NO3S/c1-5-2-3-7(13-5)8-10-6(4-14-8)9(11)12/h2-3,6,8,10H,4H2,1H3,(H,11,12)
InChI key:InChIKey=FKQBFGPLBKOCDT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1NC(SC1)C=2OC(C)=CC2
Synonyms:
  • 2-(5-Methylfuran-2-yl)-1,3-thiazolidine-4-carboxylic acid
  • 4-Thiazolidinecarboxylic acid, 2-(5-methyl-2-furanyl)-
  • 2-(5-Methyl-2-furanyl)-4-thiazolidinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.