
CAS 7269-57-0
:N6-Hydroxy-9H-purine-2,6-diamine
Description:
N6-Hydroxy-9H-purine-2,6-diamine, also known by its CAS number 7269-57-0, is a purine derivative characterized by its structural features that include a purine base with hydroxyl and amino functional groups. This compound typically appears as a white to off-white solid and is soluble in water, which is indicative of its polar nature due to the presence of hydroxyl and amino groups. It is primarily studied for its potential biological activities, particularly in relation to its role in nucleic acid metabolism and as a precursor in the synthesis of various biologically active molecules. The presence of the hydroxyl group at the N6 position and amino groups at the 2 and 6 positions contributes to its reactivity and interaction with other biochemical entities. Additionally, it may exhibit properties relevant to pharmacology, making it of interest in medicinal chemistry and biochemistry research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H6N6O
InChI:InChI=1S/C5H6N6O/c6-5-9-3-2(7-1-8-3)4(10-5)11-12/h1,12H,(H4,6,7,8,9,10,11)
InChI key:InChIKey=UJUHACUYECLPGK-UHFFFAOYSA-N
SMILES:N(O)=C1C2=C(NC(N)=N1)N=CN2
Synonyms:- 1H-Purine-2,6-diamine, N6-hydroxy-
- 2-Amino-N6-hydroxyadenine
- Purine, 2-amino-6-(hydroxyamino)-
- 9H-Purine-2,6-diamine, N6-hydroxy-
- N6-Hydroxy-9H-purine-2,6-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.