CAS 72692-06-9
:methyl (3S,6R)-3,4,5-triacetoxy-6-hydroxy-tetrahydropyran-2-carboxylate
Description:
Methyl (3S,6R)-3,4,5-triacetoxy-6-hydroxy-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy and hydroxy groups, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methyl ester group indicates that it can undergo hydrolysis to release the corresponding carboxylic acid. The stereochemistry, denoted by the (3S,6R) configuration, suggests specific spatial arrangements of atoms that can influence the compound's biological activity and interactions with other molecules. This compound may exhibit properties typical of acetylated sugars, such as solubility in organic solvents and potential use as a building block in the synthesis of more complex molecules. Its CAS number, 72692-06-9, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H18O10
InChI:InChI=1/C13H18O10/c1-5(14)20-8-9(21-6(2)15)11(22-7(3)16)13(18)23-10(8)12(17)19-4/h8-11,13,18H,1-4H3/t8-,9?,10?,11?,13+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3,4-Tri-O-acetyl-α-D-glucuronic acid methyl ester
CAS:Formula:C13H18O10Purity:90%Color and Shape:SolidMolecular weight:334.2760(2S,3R,4S,5S,6S)-2-Hydroxy-6-(Methoxycarbonyl)Tetrahydro-2H-Pyran-3,4,5-Triyl Triacetate
CAS:<p>(2S,3R,4S,5S,6S)-2-Hydroxy-6-(Methoxycarbonyl)Tetrahydro-2H-Pyran-3,4,5-Triyl Triacetate</p>Purity:98%Molecular weight:334.28g/mol(2S,3R,4S,5S,6S)-2-Hydroxy-6-(methoxycarbonyl)tetrahydro-2H-pyran-3,4,5-triyl triacetate
CAS:Purity:90%Molecular weight:334.092,3,4-Tri-O-acetyl-D-glucuronic Acid Methyl Ester
CAS:Controlled Product<p>Stability Acid Sensitive<br>Applications 2,3,4-Tri-O-acetyl-D-glucuronic Acid Methyl Ester (cas# 3082-95-9) is a compound useful in organic synthesis.<br></p>Formula:C13H18O10Color and Shape:WhiteMolecular weight:334.282,3,4-Tri-O-acetyl-a-D-glucuronic acid methyl ester
CAS:<p>2,3,4-Tri-O-acetyl-a-D-glucuronic acid methyl ester is a hydroxylated glucuronic acid that is found in the structural skeleton of many organisms. It has been shown to have isosteric properties and it can be used as a transport agent for xenobiotics. 2,3,4-Tri-O-acetyl-a-D-glucuronic acid methyl ester is metabolized by alcohols and hydrolysis to form adducts with nitrosoamines. These adducts are excreted from the body through urine.</p>Formula:C13H18O10Purity:Min. 95%Color and Shape:White PowderMolecular weight:334.28 g/mol





