CymitQuimica logo

CAS 72692-06-9

:

methyl (3S,6R)-3,4,5-triacetoxy-6-hydroxy-tetrahydropyran-2-carboxylate

Description:
Methyl (3S,6R)-3,4,5-triacetoxy-6-hydroxy-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy and hydroxy groups, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methyl ester group indicates that it can undergo hydrolysis to release the corresponding carboxylic acid. The stereochemistry, denoted by the (3S,6R) configuration, suggests specific spatial arrangements of atoms that can influence the compound's biological activity and interactions with other molecules. This compound may exhibit properties typical of acetylated sugars, such as solubility in organic solvents and potential use as a building block in the synthesis of more complex molecules. Its CAS number, 72692-06-9, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H18O10
InChI:InChI=1/C13H18O10/c1-5(14)20-8-9(21-6(2)15)11(22-7(3)16)13(18)23-10(8)12(17)19-4/h8-11,13,18H,1-4H3/t8-,9?,10?,11?,13+/m0/s1
InChI key:CLHFNXQWJBTGBL-SHXYABRHSA-N
SMILES:CC(=O)O[C@H]1C(C([C@@H](OC1C(=O)OC)O)OC(=O)C)OC(=O)C
Found 6 products.