CAS 72699-18-4

4-(4-chlorophenoxy)-2,2-dimethyl-4-(1H-1,2,4-triazol-1-yl)butane-1,3-diol

Description:

4-(4-chlorophenoxy)-2,2-dimethyl-4-(1H-1,2,4-triazol-1-yl)butane-1,3-diol, with CAS number 72699-18-4, is a chemical compound that exhibits properties typical of both phenolic and triazole functionalities. This compound features a chlorophenoxy group, which enhances its potential as a herbicide or fungicide due to its ability to disrupt plant growth processes. The presence of the triazole moiety suggests antifungal activity, as triazoles are known to inhibit the synthesis of ergosterol, a critical component of fungal cell membranes. The diol functional groups in the structure may contribute to its solubility and reactivity, allowing for various applications in agricultural chemistry. Additionally, the compound's structural complexity indicates potential for interactions with biological systems, making it of interest for further research in both environmental and medicinal chemistry. Its stability, solubility, and bioactivity would be key factors in determining its practical applications and safety profile in various formulations.

Formula: C₁₄H₁₈ClN₃O₃

InChI: InChI=1/C14H18ClN3O3/c1-14(2,7-19)12(20)13(18-9-16-8-17-18)21-11-5-3-10(15)4-6-11/h3-6,8-9,12-13,19-20H,7H2,1-2H3

SMILES: CC(C)(CO)C(C(n1cncn1)Oc1ccc(cc1)Cl)O

Synonyms:

• 72699-18-4
• Triadimefon metabolite
• Triadimenol metabolite

Triadimenol-tert-butylhydroxy

Controlled Product

CAS: 72699-18-4

Formula: C₁₄H₁₈ClN₃O₃

Color and Shape: Neat

Molecular weight: 311.76

Ref: 04-C17621500

KWG 1342

Controlled Product

CAS: 72699-18-4

Formula: C₁₄H₁₈ClN₃O₃

Color and Shape: Neat

Molecular weight: 311.76

Ref: TR-K660445

Triadimenol-tert-butylhydroxy

CAS: 72699-18-4

Triadimenol-tert-butylhydroxy is a systemic fungicide, originating from synthetic chemical processes, characterized by its ability to inhibit fungal sterol biosynthesis. This sterol biosynthesis disruption occurs through the demethylation of lanosterol or 24-methylene dihydrolanosterol, which impedes the production of ergosterol, a crucial component in fungal cell membranes. The inhibition results in disrupted cell membrane integrity and impaired fungal growth, leading to effective control over a range of plant-pathogenic fungi.

Formula: C₁₄H₁₈ClN₃O₃

Purity: Min. 95%

Molecular weight: 311.76 g/mol

Ref: 3D-XCA69918