CAS 727-49-1
:1,3,4,5,6,7,8-heptafluoronaphthalen-2-ol
Description:
1,3,4,5,6,7,8-Heptafluoronaphthalen-2-ol, with the CAS number 727-49-1, is a fluorinated organic compound characterized by the presence of seven fluorine atoms attached to a naphthalene ring, specifically at the 1, 3, 4, 5, 6, 7, and 8 positions, along with a hydroxyl (-OH) group at the 2-position. This unique structure imparts significant chemical stability and hydrophobic properties, making it useful in various applications, including as a potential intermediate in the synthesis of fluorinated compounds. The presence of multiple fluorine atoms enhances its thermal and chemical resistance, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and reactivity. The compound is typically colorless to pale yellow and may exhibit low volatility due to its high molecular weight and strong intermolecular forces. Its fluorinated nature also suggests potential applications in specialized fields such as pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often sought for their unique properties.
Formula:C10HF7O
InChI:InChI=1/C10HF7O/c11-3-1-2(4(12)8(16)7(3)15)6(14)10(18)9(17)5(1)13/h18H
SMILES:c12c(c(c(c(c1F)F)F)F)c(c(c(c2F)F)O)F
Synonyms:- 1,3,4,5,6,7,8-Heptafluoro-2-naphthol
- 2-Naphthalenol, 1,3,4,5,6,7,8-Heptafluoro-
- Heptafluoro-2-naphthol97%
- HEPTAFLUORO-2-NAPHTHOL
- Perfluoro-2-naphthol
- beta-Hydroxy-heptafluoronaphthalene,97%
- 1,3,4,5,6,7,8-Heptafluoronaphthalen-2-ol
- BETA-HYDROXY-HEPTAFLUORONAPHTHALENE
- Heptafluoro-2-naphthol 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,4,5,6,7,8-Heptafluoronaphthalen-2-ol
CAS:Formula:C10HF7OPurity:95%Color and Shape:SolidMolecular weight:270.1032Heptafluoro-2-naphthol
CAS:Heptafluoro-2-naphtholFormula:C10HF7OPurity:95%Color and Shape: powderMolecular weight:270.10g/molHeptafluoro-2-naphthol
CAS:Heptafluoro-2-naphthol is a borohydride reduction product of pentafluorophenol. It is activated at temperatures above 200°C and can be used in the synthesis of amines and transfer reactions, including oriented addition and vibrational mixing. Heptafluoro-2-naphthol has been shown to produce fluorescence when irradiated with ultraviolet light. Fluorescence can be used for the detection of this compound by using a technique called ion pairing. This compound can also be reduced to heptafluoro-2-naphthyl cation by sodium borohydride, which has applications in organic synthesis.
Formula:C10HF7OPurity:Min. 95 Area-%Color and Shape:PowderMolecular weight:270.1 g/molHeptafluoronaphthalen-2-ol
CAS:Controlled ProductFormula:C10HF7OColor and Shape:NeatMolecular weight:270.1



