CAS 7271-44-5

3H-1,2,4-Triazole-3-thione, 1,2-dihydro-5-methyl-

Description:

3H-1,2,4-Triazole-3-thione, 1,2-dihydro-5-methyl- (CAS 7271-44-5) is a heterocyclic compound characterized by its triazole ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential applications in various chemical processes. The methyl group at the 5-position of the triazole ring enhances its lipophilicity and may influence its biological activity. This compound is often studied for its potential as a fungicide or in agricultural applications due to its ability to inhibit certain biological pathways in fungi. Additionally, its unique structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis. The compound is typically handled with standard safety precautions, as with many sulfur-containing heterocycles, due to potential toxicity and reactivity.

Formula: C₃H₅N₃S

InChI: InChI=1/C3H5N3S/c1-2-4-3(7)6-5-2/h1H3,(H2,4,5,6,7)

SMILES: Cc1nc(n[nH]1)S

Synonyms:

• 5-Methyl-1,2,4-triazole-3-thiol
• 5-methyl-3H-1,2,4-triazole-3-thione
• 5-methyl-1,2-dihydro-3H-1,2,4-triazole-3-thione

3-METHYL-1,2,4-TRIAZOLE-5-THIONE

CAS: 7271-44-5

Formula: C₃H₅N₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 115.1569

Ref: IN-DA005FIE

5-methyl-4H-1,2,4-triazole-3-thiol

CAS: 7271-44-5

5-methyl-4H-1,2,4-triazole-3-thiol

Purity: 98%

Molecular weight: 115.16g/mol

Ref: 54-OR22422

3-Methyl-1H(4H)-1,2,4-triazole-5-thione

CAS: 7271-44-5

Formula: C₃H₅N₃S

Color and Shape: Neat

Molecular weight: 115.157

Ref: TR-M331225

5-Methyl-4H-1,2,4-triazole-3-thiol

CAS: 7271-44-5

Formula: C₃H₅N₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 115.15

Ref: 10-F068983

3-Methyl-1H-1,2,4-triazole-5-thiol

CAS: 7271-44-5

3-Methyl-1H-1,2,4-triazole-5-thiol is a coagulant agent that has been shown to be effective in the field of wastewater treatment. 3-Methyl-1H-1,2,4-triazole-5-thiol binds metal ions and prevents them from catalyzing reactions in the filtrate. It also has an inhibitory effect on polymerization reactions by binding to functional groups. 3MTH is used as a coagulant additive in many industries, such as papermaking, textile printing and dyeing, food processing and leather tanning. The use of 3MTH has been shown to reduce the amount of water needed during the production process. This product can also be used for coatings and other applications where it is necessary to prevent corrosion or environmental pollution by metal ions.

Formula: C₃H₅N₃S

Purity: Min. 95%

Molecular weight: 115.16 g/mol

Ref: 3D-FM123874