CAS 72715-03-8

(4aR,6aS,9aR)-1,2,4,4a,6a,7,8,9-Octahydro-8,8-dimethyl-1-methylene-2-oxopentaleno[1,6a-c]pyran-5-carboxylic acid

Description:

The chemical substance with the name "(4aR,6aS,9aR)-1,2,4,4a,6a,7,8,9-Octahydro-8,8-dimethyl-1-methylene-2-oxopentaleno[1,6a-c]pyran-5-carboxylic acid" and CAS number "72715-03-8" is a complex organic compound characterized by its multi-cyclic structure and specific stereochemistry. It features a pentaleno[1,6a-c]pyran core, which contributes to its unique chemical properties. The presence of multiple chiral centers indicates that the compound can exist in various stereoisomeric forms, influencing its biological activity and reactivity. The carboxylic acid functional group suggests potential for hydrogen bonding and reactivity in various chemical reactions, including esterification and acid-base reactions. Additionally, the dimethyl and methylene groups contribute to its hydrophobic characteristics, which may affect its solubility in different solvents. Overall, this compound's intricate structure and functional groups make it of interest in fields such as medicinal chemistry and natural product synthesis, where it may exhibit specific biological activities or serve as a precursor for further chemical modifications.

Formula: C₁₅H₁₈O₄

InChI: InChI=1S/C15H18O4/c1-8-13(18)19-6-11-10(12(16)17)4-9-5-14(2,3)7-15(8,9)11/h4,9,11H,1,5-7H2,2-3H3,(H,16,17)/t9-,11+,15-/m1/s1

InChI key: InChIKey=VDWJABPVVAYLBS-BPYAMOTFSA-N

SMILES: C=C1[C@@]23[C@](C(C(O)=O)=C[C@@]2(CC(C)(C)C3)[H])(COC1=O)[H]

Synonyms:

• (4aR,6aS,9aR)-1,2,4,4a,6a,7,8,9-Octahydro-8,8-dimethyl-1-methylene-2-oxopentaleno[1,6a-c]pyran-5-carboxylic acid
• Pentaleno[1,6a-c]pyran-5-carboxylic acid, 1,2,4,4a,6a,7,8,9-octahydro-8,8-dimethyl-1-methylene-2-oxo-, (4aR,6aS,9aR)-
• Pentalenolactone E
• Pentaleno[1,6a-c]pyran-5-carboxylic acid, 1,2,4,4a,6a,7,8,9-octahydro-8,8-dimethyl-1-methylene-2-oxo-, [4aR-(4aα,6aβ,9aR*)]-

Pentalenolactone E

CAS: 72715-03-8

Pentalenolactone E is a useful organic compound for research related to life sciences. The catalog number is T124322 and the CAS number is 72715-03-8.

Formula: C₁₅H₁₈O₄

Color and Shape: Solid

Molecular weight: 262.305

Ref: TM-T124322