CAS 72716-87-1

2-methoxyisonicotinaldehyde

Description:

2-Methoxyisonicotinaldehyde is an organic compound characterized by its pyridine ring structure, which is substituted with a methoxy group and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure includes a methoxy group (-OCH3) attached to the 2-position of the isonicotinaldehyde framework, which contributes to its unique chemical reactivity and potential applications. The presence of the aldehyde group allows for various chemical transformations, making it useful in synthetic organic chemistry. Additionally, 2-methoxyisonicotinaldehyde may exhibit biological activity, which has led to interest in its potential as a pharmaceutical intermediate or in other applications such as agrochemicals. Its properties, including melting point, boiling point, and spectral data, can vary based on purity and specific conditions, making it essential to refer to detailed experimental data for precise applications.

Formula: C₇H₇NO₂

InChI: InChI=1/C7H7NO2/c1-10-7-4-6(5-9)2-3-8-7/h2-5H,1H3

SMILES: COc1cc(ccn1)C=O

Synonyms:

• 2-Methoxypyridine-4-carboxaldehyde
• 4-Pyridinecarboxaldehyde, 2-Methoxy-
• 2-Methoxypyridine-4-Carbaldehyde
• 4-Formyl-2-methoxypyridine

2-Methoxyisonicotinaldehyde

CAS: 72716-87-1

Formula: C₇H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 137.1360

Ref: IN-DA005FIC

2-Methoxyisonicotinaldehyde

CAS: 72716-87-1

2-Methoxyisonicotinaldehyde

Formula: C₇H₇NO₂

Purity: 98%

Color and Shape: white to off-white solid

Molecular weight: 137.14g/mol

Ref: 54-OR46110

2-Methoxyisonicotinaldehyde

CAS: 72716-87-1

Formula: C₇H₇NO₂

Purity: 97%

Color and Shape: Crystalline

Molecular weight: 137.138

Ref: 10-F065204