CAS 72716-93-9
:5-[(6-Methyl-3-pyridinyl)methyl]-2-(nitroamino)-4(3H)-pyrimidinone
Description:
5-[(6-Methyl-3-pyridinyl)methyl]-2-(nitroamino)-4(3H)-pyrimidinone, with the CAS number 72716-93-9, is a chemical compound characterized by its complex structure, which includes a pyrimidinone core substituted with a nitroamino group and a 6-methyl-3-pyridinyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing functional groups. The presence of the nitroamino group may impart specific reactivity and influence its solubility and stability in various solvents. Additionally, the methyl and pyridinyl substituents can affect the compound's lipophilicity and interaction with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its potential applications in pharmaceuticals or agrochemicals. As with many such compounds, safety data and handling precautions should be observed due to the presence of nitro groups, which can be sensitive to reduction and may pose hazards.
Formula:C11H11N5O3
InChI:InChI=1S/C11H11N5O3/c1-7-2-3-8(5-12-7)4-9-6-13-11(14-10(9)17)15-16(18)19/h2-3,5-6H,4H2,1H3,(H2,13,14,15,17)
InChI key:InChIKey=KWBSLRQDOHBJPQ-UHFFFAOYSA-N
SMILES:C(C=1C(=O)NC(NN(=O)=O)=NC1)C=2C=CC(C)=NC2
Synonyms:- 2-Nitroamino-5-(6-methylpyrid-3-ylmethyl)-4(1H)-pyrimidone
- 4(1H)-Pyrimidinone, 5-[(6-methyl-3-pyridinyl)methyl]-2-(nitroamino)-
- 4(3H)-Pyrimidinone, 5-[(6-methyl-3-pyridinyl)methyl]-2-(nitroamino)-
- 5-[(6-Methyl-3-pyridinyl)methyl]-2-(nitroamino)-4(3H)-pyrimidinone
- 5-[(6-methylpyridin-3-yl)methyl]-2-(nitroamino)pyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.