CAS 7272-84-6

3-(pyridin-4-yl)-1H-indole

Description:

3-(Pyridin-4-yl)-1H-indole, with the CAS number 7272-84-6, is an organic compound characterized by its indole and pyridine functional groups. This compound features a pyridine ring substituted at the 4-position with an indole moiety, which contributes to its potential biological activity. Indoles are known for their presence in various natural products and pharmaceuticals, while pyridine rings are often associated with basicity and aromatic stability. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the presence of both aromatic systems may influence its electronic properties, reactivity, and ability to participate in various chemical reactions. Overall, 3-(pyridin-4-yl)-1H-indole is a compound of interest for further research in the fields of organic synthesis and pharmacology.

Formula: C₁₃H₁₀N₂

InChI: InChI=1/C13H10N2/c1-2-4-13-11(3-1)12(9-15-13)10-5-7-14-8-6-10/h1-9,15H

SMILES: c1ccc2c(c1)c(c[nH]2)c1ccncc1

Synonyms:

• 1H-Indole, 3-(4-pyridinyl)-
• 3-(4-pyridinyl)-1H-indole
• 3-(4-Pyridyl)indole