CAS 72732-51-5

4-hydroxy-2-(4-hydroxyphenyl)-1,5-dimethyl-1,2-dihydro-3H-pyrazol-3-one

Description:

4-Hydroxy-2-(4-hydroxyphenyl)-1,5-dimethyl-1,2-dihydro-3H-pyrazol-3-one, with CAS number 72732-51-5, is a chemical compound characterized by its pyrazolone structure, which includes a hydrazone moiety. This compound features two hydroxyl groups, contributing to its potential as a phenolic antioxidant. The presence of the dimethyl groups enhances its lipophilicity, which may influence its solubility and reactivity in various environments. The compound is likely to exhibit biological activity, potentially acting as an anti-inflammatory or analgesic agent due to its structural similarities to other known pharmacologically active pyrazolones. Its molecular structure suggests that it may participate in hydrogen bonding, which can affect its interactions with biological macromolecules. Additionally, the compound's stability and reactivity can be influenced by pH and temperature, making it important to consider these factors in experimental applications. Overall, this compound's unique structural features and functional groups make it a subject of interest in medicinal chemistry and material science.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1/C11H12N2O3/c1-7-10(15)11(16)13(12(7)2)8-3-5-9(14)6-4-8/h3-6,14-15H,1-2H3

SMILES: Cc1c(c(=O)n(c2ccc(cc2)O)n1C)O

Synonyms:

• 3H-Pyrazol-3-one, 1,2-dihydro-4-hydroxy-2-(4-hydroxyphenyl)-1,5-dimethyl