CAS 72734-63-5

4-(1-hydroxy-2-{[4-(2-methoxyphenyl)-2-methylbutan-2-yl]amino}ethyl)phenol

Description:

4-(1-hydroxy-2-{[4-(2-methoxyphenyl)-2-methylbutan-2-yl]amino}ethyl)phenol, with the CAS number 72734-63-5, is a chemical compound characterized by its complex structure, which includes a phenolic group and an aminoalkyl side chain. This compound typically exhibits properties associated with both phenols and amines, such as potential antioxidant activity due to the presence of the hydroxyl group. It may also demonstrate solubility in organic solvents, depending on the substituents on the aromatic rings. The presence of the methoxy group can influence its reactivity and interaction with biological systems. Additionally, the bulky aliphatic chain may affect its steric properties and overall molecular conformation. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in drug design and development, due to their ability to interact with biological targets. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies.

Formula: C₂₀H₂₇NO₃

InChI: InChI=1/C20H27NO3/c1-20(2,13-12-16-6-4-5-7-19(16)24-3)21-14-18(23)15-8-10-17(22)11-9-15/h4-11,18,21-23H,12-14H2,1-3H3

SMILES: CC(C)(CCc1ccccc1OC)NCC(c1ccc(cc1)O)O

4-Hydroxy-α-(((3-(2-methoxyphenyl)-1,1-dimethylpropyl)amino)methyl)benzenemethanol

CAS: 72734-63-5

4-Hydroxy-α-(((3-(2-methoxyphenyl)-1,1-dimethylpropyl)amino)methyl)benzenemethanol is a synthetic compound classified as a beta-adrenergic agonist. This chemical is derived from laboratory synthesis, involving the modification of phenylethanolamine structures to achieve specific adrenergic properties.

Formula: C₂₀H₂₇NO₃

Purity: Min. 95%

Molecular weight: 329.4 g/mol

Ref: 3D-XCA73463

D2343

CAS: 72734-63-5

D2343 is an agonist of β2-adrenoceptor. It also is an inhibitor of α1- adrenoceptor.

Formula: C₂₀H₂₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 329.43

Ref: TM-T15042