CAS 72735-51-4

2′,3′-Dihydrospiro[furan-3(4H),1′-[1H]indene]-2,5-dione

Description:

2′,3′-Dihydrospiro[furan-3(4H),1′-[1H]indene]-2,5-dione, with the CAS number 72735-51-4, is a chemical compound characterized by its unique spirocyclic structure, which combines a furan ring and an indene moiety. This compound typically exhibits a range of chemical properties, including potential reactivity due to the presence of the dione functional groups, which can participate in various chemical reactions such as nucleophilic additions or cycloadditions. Its structure suggests that it may have interesting electronic properties, possibly making it a candidate for applications in organic electronics or as a building block in organic synthesis. Additionally, the presence of multiple rings may contribute to its stability and influence its solubility in different solvents. While specific physical properties such as melting point, boiling point, and solubility can vary, they are essential for understanding its behavior in various chemical environments. Overall, 2′,3′-Dihydrospiro[furan-3(4H),1′-[1H]indene]-2,5-dione represents a fascinating compound for further study in organic chemistry and materials science.

Formula: C₁₂H₁₀O₃

InChI: InChI=1S/C12H10O3/c13-10-7-12(11(14)15-10)6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2

InChI key: InChIKey=JXJAHNQEJPFBPV-UHFFFAOYSA-N

SMILES: O=C1C2(C=3C(CC2)=CC=CC3)CC(=O)O1

Synonyms:

• 2′,3′-Dihydrospiro[furan-3(4H),1′-[1H]indene]-2,5-dione
• Spiro[furan-3(2H),1′-[1H]indene]-2,5(4H)-dione, 2′,3′-dihydro-
• Spiro[furan-3(4H),1′-[1H]indene]-2,5-dione, 2′,3′-dihydro-
• 2,3-Dihydrospiro[indene-1,3′-oxolane]-2′,5′-dione