CymitQuimica logo

CAS 72736-57-3

:

4,6-Dibromo-1,3-benzodioxole

Description:
4,6-Dibromo-1,3-benzodioxole is an organic compound characterized by its unique structure, which features a benzodioxole core substituted with bromine atoms at the 4 and 6 positions. This compound is typically a pale yellow to brown solid, exhibiting a relatively low solubility in water but good solubility in organic solvents such as ethanol and dichloromethane. The presence of bromine atoms enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the field of organic chemistry. It may also exhibit interesting biological activities, although specific studies on its pharmacological properties may be limited. The compound's molecular structure contributes to its potential as a precursor in the synthesis of more complex molecules or as a reagent in various chemical reactions. Safety precautions should be observed when handling this compound, as brominated compounds can pose health risks. Overall, 4,6-Dibromo-1,3-benzodioxole is a notable compound in synthetic organic chemistry with potential applications in research and industry.
Formula:C7H4Br2O2
InChI:InChI=1S/C7H4Br2O2/c8-4-1-5(9)7-6(2-4)10-3-11-7/h1-2H,3H2
InChI key:InChIKey=PHXYSVGTRLPSMD-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(Br)=C1)OCO2
Synonyms:
  • 1,3-Benzodioxole, 4,6-dibromo-
  • 4,6-Dibromo-1,3-benzodioxole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.