CAS 7274-07-9
:4-decanoyl-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
Description:
4-Decanoyl-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one, with the CAS number 7274-07-9, is a synthetic organic compound characterized by its complex spirocyclic structure, which incorporates both benzofuran and xanthenone moieties. This compound typically exhibits a range of functional groups, including hydroxyl groups that contribute to its solubility and reactivity. It is known for its potential applications in various fields, including organic electronics and as a dye or pigment due to its chromophoric properties. The presence of the decanoyl group suggests that it may have hydrophobic characteristics, influencing its interactions in biological systems or materials science. Additionally, the dihydroxy substitutions may enhance its reactivity and ability to form hydrogen bonds, which can be significant in biological or chemical processes. Overall, this compound's unique structure and functional groups make it a subject of interest for further research in both synthetic and applied chemistry.
Formula:C30H30O6
InChI:InChI=1/C30H30O6/c1-2-3-4-5-6-7-8-12-25(33)21-10-9-11-24-28(21)29(34)36-30(24)22-15-13-19(31)17-26(22)35-27-18-20(32)14-16-23(27)30/h9-11,13-18,31-32H,2-8,12H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decanoyl fluorescein
CAS:Decanoyl fluorescein is a biochemical.Formula:C30H30O6Color and Shape:SolidMolecular weight:486.56
