CAS 727409-20-3

ethyl 4-[(6-chloropyridin-3-yl)carbonyl]benzoate

Description:

Ethyl 4-[(6-chloropyridin-3-yl)carbonyl]benzoate, identified by its CAS number 727409-20-3, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethyl alcohol. The structure features a benzoate moiety linked to a 6-chloropyridine ring through a carbonyl group, indicating it has both aromatic and heterocyclic characteristics. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the aromatic systems, which can influence its solubility and reactivity. The chloropyridine substituent may impart specific electronic properties, potentially affecting its biological activity and interactions with other molecules. Ethyl 4-[(6-chloropyridin-3-yl)carbonyl]benzoate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including esterification and possibly halogenation reactions.

Formula: C₁₅H₁₂ClNO₃

InChI: InChI=1/C15H12ClNO3/c1-2-20-15(19)11-5-3-10(4-6-11)14(18)12-7-8-13(16)17-9-12/h3-9H,2H2,1H3

SMILES: CCOC(=O)c1ccc(cc1)C(=O)c1ccc(Cl)nc1

Synonyms:

• 4-(6-Chloropyridine-3-carbonyl)benzoic acid ethyl ester